About dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane
dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane (PubChem CID 134832689) has the molecular formula C14H12Cl2O4P2Pd
and a molecular weight of 483.52 g/mol. Its IUPAC name is dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane.
Molecular Properties
| Compound Name | dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane |
| PubChem CID | 134832689 |
| Molecular Formula | C14H12Cl2O4P2Pd |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 481.86 |
| IUPAC Name | dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane |
| SMILES | Cl[Pd]Cl.Pc1ccc2c(c1-c1c(P)ccc3c1OCO3)OCO2 |
| InChI | InChI=1S/C14H12O4P2.2ClH.Pd/c19-9-3-1-7-13(17-5-15-7)11(9)12-10(20)4-2-8-14(12)18-6-16-8;;;/h1-4H,5-6,19-20H2;2*1H;/q;;;+2/p-2 |
| InChIKey | WBVHIORGKJTYQM-UHFFFAOYSA-L |
| XLogP | 3.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane?
The IUPAC name of dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane (CID 134832689) is dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane.
What is the SMILES notation for dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane?
The canonical SMILES for dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane is Cl[Pd]Cl.Pc1ccc2c(c1-c1c(P)ccc3c1OCO3)OCO2.
What is the InChIKey of dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane?
The InChIKey is WBVHIORGKJTYQM-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H12O4P2.2ClH.Pd/c19-9-3-1-7-13(17-5-15-7)11(9)12-10(20)4-2-8-14(12)18-6-16-8;;;/h1-4H,5-6,19-20H2;2*1H;/q;;;+2/p-2.
What are the key properties of dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane?
dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane has a molecular weight of 483.52 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane is sourced from PubChem (CID 134832689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).