C14H12Cl2O4P2Pd — CID 134832689
dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane (PubChem CID 134832689) has the molecular formula C14H12Cl2O4P2Pd and a molecular weight of 483.52 g/mol. Its IUPAC name is dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane.
| Compound Name | dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane |
|---|---|
| PubChem CID | 134832689 |
| Molecular Formula | C14H12Cl2O4P2Pd |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 481.86 |
| IUPAC Name | dichloropalladium;[4-(5-phosphanyl-1,3-benzodioxol-4-yl)-1,3-benzodioxol-5-yl]phosphane |
| SMILES | Cl[Pd]Cl.Pc1ccc2c(c1-c1c(P)ccc3c1OCO3)OCO2 |
| InChI | InChI=1S/C14H12O4P2.2ClH.Pd/c19-9-3-1-7-13(17-5-15-7)11(9)12-10(20)4-2-8-14(12)18-6-16-8;;;/h1-4H,5-6,19-20H2;2*1H;/q;;;+2/p-2 |
| InChIKey | WBVHIORGKJTYQM-UHFFFAOYSA-L |
| XLogP | 3.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|