C10H8O2 — CID 19761193
6-methylcyclobuta[g][1,3]benzodioxole (PubChem CID 19761193) has the molecular formula C10H8O2 and a molecular weight of 160.17 g/mol. Its IUPAC name is 6-methylcyclobuta[g][1,3]benzodioxole.
| Compound Name | 6-methylcyclobuta[g][1,3]benzodioxole |
|---|---|
| PubChem CID | 19761193 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 6-methylcyclobuta[g][1,3]benzodioxole |
| SMILES | CC1=Cc2c1ccc1c2OCO1 |
| InChI | InChI=1S/C10H8O2/c1-6-4-8-7(6)2-3-9-10(8)12-5-11-9/h2-4H,5H2,1H3 |
| InChIKey | MOPOSTXKVMVTQQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |