C12H13N3O2 — CID 117334125
1-methyl-3-(4-methyl-1,3-benzodioxol-5-yl)pyrazol-5-amine (PubChem CID 117334125) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-methyl-3-(4-methyl-1,3-benzodioxol-5-yl)pyrazol-5-amine.
| Compound Name | 1-methyl-3-(4-methyl-1,3-benzodioxol-5-yl)pyrazol-5-amine |
|---|---|
| PubChem CID | 117334125 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-methyl-3-(4-methyl-1,3-benzodioxol-5-yl)pyrazol-5-amine |
| SMILES | Cc1c(-c2cc(N)n(C)n2)ccc2c1OCO2 |
| InChI | InChI=1S/C12H13N3O2/c1-7-8(9-5-11(13)15(2)14-9)3-4-10-12(7)17-6-16-10/h3-5H,6,13H2,1-2H3 |
| InChIKey | DJTGOMHPXYGTIZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |