C11H10ClN3O2 — CID 117382468
3-(4-chloro-1,3-benzodioxol-5-yl)-1-methylpyrazol-5-amine (PubChem CID 117382468) has the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. Its IUPAC name is 3-(4-chloro-1,3-benzodioxol-5-yl)-1-methylpyrazol-5-amine.
| Compound Name | 3-(4-chloro-1,3-benzodioxol-5-yl)-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 117382468 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 3-(4-chloro-1,3-benzodioxol-5-yl)-1-methylpyrazol-5-amine |
| SMILES | Cn1nc(-c2ccc3c(c2Cl)OCO3)cc1N |
| InChI | InChI=1S/C11H10ClN3O2/c1-15-9(13)4-7(14-15)6-2-3-8-11(10(6)12)17-5-16-8/h2-4H,5,13H2,1H3 |
| InChIKey | YUYZOPBUDGRXIA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |