C9H7NO3 — CID 71303966
6,7-dihydro-[1,3]dioxolo[4,5-g]isoindol-8-one (PubChem CID 71303966) has the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. Its IUPAC name is 6,7-dihydro-[1,3]dioxolo[4,5-g]isoindol-8-one.
| Compound Name | 6,7-dihydro-[1,3]dioxolo[4,5-g]isoindol-8-one |
|---|---|
| PubChem CID | 71303966 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 6,7-dihydro-[1,3]dioxolo[4,5-g]isoindol-8-one |
| SMILES | O=C1NCc2ccc3c(c21)OCO3 |
| InChI | InChI=1S/C9H7NO3/c11-9-7-5(3-10-9)1-2-6-8(7)13-4-12-6/h1-2H,3-4H2,(H,10,11) |
| InChIKey | BYAFKVRZEGMBQD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |