C15H13NO3 — CID 57310561
6-ethyl-8,9-dihydro-[1,3]benzodioxolo[7,6-f]isoindol-7-one (PubChem CID 57310561) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is 6-ethyl-8,9-dihydro-[1,3]benzodioxolo[7,6-f]isoindol-7-one.
| Compound Name | 6-ethyl-8,9-dihydro-[1,3]benzodioxolo[7,6-f]isoindol-7-one |
|---|---|
| PubChem CID | 57310561 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 6-ethyl-8,9-dihydro-[1,3]benzodioxolo[7,6-f]isoindol-7-one |
| SMILES | CCc1c2c(cc3c4c(ccc13)OCO4)CNC2=O |
| InChI | InChI=1S/C15H13NO3/c1-2-9-10-3-4-12-14(19-7-18-12)11(10)5-8-6-16-15(17)13(8)9/h3-5H,2,6-7H2,1H3,(H,16,17) |
| InChIKey | CODXFGQHSUXJDY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |