C10H11ClO5S — CID 84714862
2-(4-methoxy-1,3-benzodioxol-5-yl)ethanesulfonyl chloride (PubChem CID 84714862) has the molecular formula C10H11ClO5S and a molecular weight of 278.71 g/mol. Its IUPAC name is 2-(4-methoxy-1,3-benzodioxol-5-yl)ethanesulfonyl chloride.
| Compound Name | 2-(4-methoxy-1,3-benzodioxol-5-yl)ethanesulfonyl chloride |
|---|---|
| PubChem CID | 84714862 |
| Molecular Formula | C10H11ClO5S |
| Molecular Weight | 278.71 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | 2-(4-methoxy-1,3-benzodioxol-5-yl)ethanesulfonyl chloride |
| SMILES | COc1c(CCS(=O)(=O)Cl)ccc2c1OCO2 |
| InChI | InChI=1S/C10H11ClO5S/c1-14-9-7(4-5-17(11,12)13)2-3-8-10(9)16-6-15-8/h2-3H,4-6H2,1H3 |
| InChIKey | WPPHQORRXYCHCV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.71 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |