C24H33NO7S — CID 54215134
N-(2,2-dipropoxyethyl)-N-[(4-methoxy-1,3-benzodioxol-5-yl)methyl]-4-methylbenzenesulfonamide (PubChem CID 54215134) has the molecular formula C24H33NO7S and a molecular weight of 479.60 g/mol. Its IUPAC name is N-(2,2-dipropoxyethyl)-N-[(4-methoxy-1,3-benzodioxol-5-yl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(2,2-dipropoxyethyl)-N-[(4-methoxy-1,3-benzodioxol-5-yl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 54215134 |
| Molecular Formula | C24H33NO7S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-(2,2-dipropoxyethyl)-N-[(4-methoxy-1,3-benzodioxol-5-yl)methyl]-4-methylbenzenesulfonamide |
| SMILES | CCCOC(CN(Cc1ccc2c(c1OC)OCO2)S(=O)(=O)c1ccc(C)cc1)OCCC |
| InChI | InChI=1S/C24H33NO7S/c1-5-13-29-22(30-14-6-2)16-25(33(26,27)20-10-7-18(3)8-11-20)15-19-9-12-21-24(23(19)28-4)32-17-31-21/h7-12,22H,5-6,13-17H2,1-4H3 |
| InChIKey | PYQKUCWSVQKSFJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|