C21H21ClN2O5S — CID 3217000
N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(2-methoxyethyl)-4-methylbenzenesulfonamide (PubChem CID 3217000) has the molecular formula C21H21ClN2O5S and a molecular weight of 448.93 g/mol. Its IUPAC name is N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(2-methoxyethyl)-4-methylbenzenesulfonamide.
| Compound Name | N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(2-methoxyethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 3217000 |
| Molecular Formula | C21H21ClN2O5S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(2-methoxyethyl)-4-methylbenzenesulfonamide |
| SMILES | COCCN(Cc1cc2cc3c(cc2nc1Cl)OCO3)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H21ClN2O5S/c1-14-3-5-17(6-4-14)30(25,26)24(7-8-27-2)12-16-9-15-10-19-20(29-13-28-19)11-18(15)23-21(16)22/h3-6,9-11H,7-8,12-13H2,1-2H3 |
| InChIKey | YHSVZGUKQUCDNQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|