C19H17ClN2O4S — CID 3216993
N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(2-methoxyethyl)thiophene-2-carboxamide (PubChem CID 3216993) has the molecular formula C19H17ClN2O4S and a molecular weight of 404.88 g/mol. Its IUPAC name is N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(2-methoxyethyl)thiophene-2-carboxamide.
| Compound Name | N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(2-methoxyethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3216993 |
| Molecular Formula | C19H17ClN2O4S |
| Molecular Weight | 404.88 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | N-[(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]-N-(2-methoxyethyl)thiophene-2-carboxamide |
| SMILES | COCCN(Cc1cc2cc3c(cc2nc1Cl)OCO3)C(=O)c1cccs1 |
| InChI | InChI=1S/C19H17ClN2O4S/c1-24-5-4-22(19(23)17-3-2-6-27-17)10-13-7-12-8-15-16(26-11-25-15)9-14(12)21-18(13)20/h2-3,6-9H,4-5,10-11H2,1H3 |
| InChIKey | YVBCJDNIKOSCAA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|