C26H30N2O4S — CID 42482769
N-(3-methoxypropyl)-N-[(6-thiophen-2-yl-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]cyclohexanecarboxamide (PubChem CID 42482769) has the molecular formula C26H30N2O4S and a molecular weight of 466.60 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N-[(6-thiophen-2-yl-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]cyclohexanecarboxamide.
| Compound Name | N-(3-methoxypropyl)-N-[(6-thiophen-2-yl-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 42482769 |
| Molecular Formula | C26H30N2O4S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-(3-methoxypropyl)-N-[(6-thiophen-2-yl-[1,3]dioxolo[4,5-g]quinolin-7-yl)methyl]cyclohexanecarboxamide |
| SMILES | COCCCN(Cc1cc2cc3c(cc2nc1-c1cccs1)OCO3)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C26H30N2O4S/c1-30-11-6-10-28(26(29)18-7-3-2-4-8-18)16-20-13-19-14-22-23(32-17-31-22)15-21(19)27-25(20)24-9-5-12-33-24/h5,9,12-15,18H,2-4,6-8,10-11,16-17H2,1H3 |
| InChIKey | APAHIGIIPYQLLS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|