C27H32N2O4 — CID 45240875
N-[[7-methoxy-2-(2-methylphenyl)quinolin-3-yl]methyl]-N-(3-methoxypropyl)oxolane-2-carboxamide (PubChem CID 45240875) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is N-[[7-methoxy-2-(2-methylphenyl)quinolin-3-yl]methyl]-N-(3-methoxypropyl)oxolane-2-carboxamide.
| Compound Name | N-[[7-methoxy-2-(2-methylphenyl)quinolin-3-yl]methyl]-N-(3-methoxypropyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 45240875 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | N-[[7-methoxy-2-(2-methylphenyl)quinolin-3-yl]methyl]-N-(3-methoxypropyl)oxolane-2-carboxamide |
| SMILES | COCCCN(Cc1cc2ccc(OC)cc2nc1-c1ccccc1C)C(=O)C1CCCO1 |
| InChI | InChI=1S/C27H32N2O4/c1-19-8-4-5-9-23(19)26-21(16-20-11-12-22(32-3)17-24(20)28-26)18-29(13-7-14-31-2)27(30)25-10-6-15-33-25/h4-5,8-9,11-12,16-17,25H,6-7,10,13-15,18H2,1-3H3 |
| InChIKey | PHYWCIORBBYOGA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|