C21H27NO6S — CID 4346
N-(1,3-benzodioxol-5-ylmethyl)-N-(2,2-diethoxyethyl)-4-methylbenzenesulfonamide (PubChem CID 4346) has the molecular formula C21H27NO6S and a molecular weight of 421.52 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-(2,2-diethoxyethyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-(2,2-diethoxyethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 4346 |
| Molecular Formula | C21H27NO6S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-(2,2-diethoxyethyl)-4-methylbenzenesulfonamide |
| SMILES | CCOC(CN(Cc1ccc2c(c1)OCO2)S(=O)(=O)c1ccc(C)cc1)OCC |
| InChI | InChI=1S/C21H27NO6S/c1-4-25-21(26-5-2)14-22(29(23,24)18-9-6-16(3)7-10-18)13-17-8-11-19-20(12-17)28-15-27-19/h6-12,21H,4-5,13-15H2,1-3H3 |
| InChIKey | CIJLDLFGMZUYNO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|