C16H16BrNO4S — CID 55374293
N-(1,3-benzodioxol-5-ylmethyl)-3-bromo-N-ethylbenzenesulfonamide (PubChem CID 55374293) has the molecular formula C16H16BrNO4S and a molecular weight of 398.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-bromo-N-ethylbenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-bromo-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 55374293 |
| Molecular Formula | C16H16BrNO4S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-bromo-N-ethylbenzenesulfonamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)S(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H16BrNO4S/c1-2-18(23(19,20)14-5-3-4-13(17)9-14)10-12-6-7-15-16(8-12)22-11-21-15/h3-9H,2,10-11H2,1H3 |
| InChIKey | LVOLITSZQBINNY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |