C20H20N2O4S — CID 46529653
N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-3-methylquinoline-8-sulfonamide (PubChem CID 46529653) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-3-methylquinoline-8-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-3-methylquinoline-8-sulfonamide |
|---|---|
| PubChem CID | 46529653 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-3-methylquinoline-8-sulfonamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)S(=O)(=O)c1cccc2cc(C)cnc12 |
| InChI | InChI=1S/C20H20N2O4S/c1-3-22(12-15-7-8-17-18(10-15)26-13-25-17)27(23,24)19-6-4-5-16-9-14(2)11-21-20(16)19/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | PMPSAPFTLRPFRX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |