C15H14BrClN2O4S — CID 55767222
N-(1,3-benzodioxol-5-ylmethyl)-5-bromo-2-chloro-N-ethylpyridine-3-sulfonamide (PubChem CID 55767222) has the molecular formula C15H14BrClN2O4S and a molecular weight of 433.71 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-bromo-2-chloro-N-ethylpyridine-3-sulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-bromo-2-chloro-N-ethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55767222 |
| Molecular Formula | C15H14BrClN2O4S |
| Molecular Weight | 433.71 g/mol |
| Exact Mass | 431.95 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-bromo-2-chloro-N-ethylpyridine-3-sulfonamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)S(=O)(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C15H14BrClN2O4S/c1-2-19(8-10-3-4-12-13(5-10)23-9-22-12)24(20,21)14-6-11(16)7-18-15(14)17/h3-7H,2,8-9H2,1H3 |
| InChIKey | CQTBHBBLOZIKSY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.71 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|