C19H24FNO5S — CID 138976845
N-(2,2-dimethoxyethyl)-N-[(4-fluoro-3-methoxyphenyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 138976845) has the molecular formula C19H24FNO5S and a molecular weight of 397.47 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-N-[(4-fluoro-3-methoxyphenyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(2,2-dimethoxyethyl)-N-[(4-fluoro-3-methoxyphenyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 138976845 |
| Molecular Formula | C19H24FNO5S |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-N-[(4-fluoro-3-methoxyphenyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | COc1cc(CN(CC(OC)OC)S(=O)(=O)c2ccc(C)cc2)ccc1F |
| InChI | InChI=1S/C19H24FNO5S/c1-14-5-8-16(9-6-14)27(22,23)21(13-19(25-3)26-4)12-15-7-10-17(20)18(11-15)24-2/h5-11,19H,12-13H2,1-4H3 |
| InChIKey | GTPPYCNBPHZFLV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|