C17H22BrNO4S2 — CID 58466455
N-[(4-bromo-5-methylthiophen-2-yl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide (PubChem CID 58466455) has the molecular formula C17H22BrNO4S2 and a molecular weight of 448.40 g/mol. Its IUPAC name is N-[(4-bromo-5-methylthiophen-2-yl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide.
| Compound Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 58466455 |
| Molecular Formula | C17H22BrNO4S2 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | N-[(4-bromo-5-methylthiophen-2-yl)methyl]-N-(2,2-dimethoxyethyl)-4-methylbenzenesulfonamide |
| SMILES | COC(CN(Cc1cc(Br)c(C)s1)S(=O)(=O)c1ccc(C)cc1)OC |
| InChI | InChI=1S/C17H22BrNO4S2/c1-12-5-7-15(8-6-12)25(20,21)19(11-17(22-3)23-4)10-14-9-16(18)13(2)24-14/h5-9,17H,10-11H2,1-4H3 |
| InChIKey | AGJTWUHOXKLBDV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|