C25H27Br2NO2S — CID 100992494
N,N-bis[(4-bromo-2,5-dimethylphenyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 100992494) has the molecular formula C25H27Br2NO2S and a molecular weight of 565.37 g/mol. Its IUPAC name is N,N-bis[(4-bromo-2,5-dimethylphenyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N,N-bis[(4-bromo-2,5-dimethylphenyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 100992494 |
| Molecular Formula | C25H27Br2NO2S |
| Molecular Weight | 565.37 g/mol |
| Exact Mass | 563.01 |
| IUPAC Name | N,N-bis[(4-bromo-2,5-dimethylphenyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2cc(C)c(Br)cc2C)Cc2cc(C)c(Br)cc2C)cc1 |
| InChI | InChI=1S/C25H27Br2NO2S/c1-16-6-8-23(9-7-16)31(29,30)28(14-21-10-19(4)24(26)12-17(21)2)15-22-11-20(5)25(27)13-18(22)3/h6-13H,14-15H2,1-5H3 |
| InChIKey | NGRQADUSAROKJC-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.37 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |