C12H14ClN3O3S2 — CID 61040679
2-chloro-N-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)pyrimidine-5-sulfonamide (PubChem CID 61040679) has the molecular formula C12H14ClN3O3S2 and a molecular weight of 347.85 g/mol. Its IUPAC name is 2-chloro-N-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)pyrimidine-5-sulfonamide.
| Compound Name | 2-chloro-N-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 61040679 |
| Molecular Formula | C12H14ClN3O3S2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 2-chloro-N-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)pyrimidine-5-sulfonamide |
| SMILES | COCCN(Cc1cccs1)S(=O)(=O)c1cnc(Cl)nc1 |
| InChI | InChI=1S/C12H14ClN3O3S2/c1-19-5-4-16(9-10-3-2-6-20-10)21(17,18)11-7-14-12(13)15-8-11/h2-3,6-8H,4-5,9H2,1H3 |
| InChIKey | XBCPUXXTGYMLOK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |