6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride

C11H10ClNO3S2 — CID 112572719

IUPAC6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(OCCc2cccs2)nc1
InChIInChI=1S/C11H10ClNO3S2/c12-18(14,15)10-3-4-11(13-8-10)16-6-5-9-2-1-7-17-9/h1-4,7-8H,5-6H2
InChIKeyVYWREPOBUXAJBQ-UHFFFAOYSA-N
MW303.79 g/mol
LogP2.69
Rot. Bonds5

About 6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride

6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride (PubChem CID 112572719) has the molecular formula C11H10ClNO3S2 and a molecular weight of 303.79 g/mol. Its IUPAC name is 6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride.

Molecular Properties

Compound Name6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride
PubChem CID112572719
Molecular FormulaC11H10ClNO3S2
Molecular Weight303.79 g/mol
Exact Mass302.98
IUPAC Name6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride
SMILESO=S(=O)(Cl)c1ccc(OCCc2cccs2)nc1
InChIInChI=1S/C11H10ClNO3S2/c12-18(14,15)10-3-4-11(13-8-10)16-6-5-9-2-1-7-17-9/h1-4,7-8H,5-6H2
InChIKeyVYWREPOBUXAJBQ-UHFFFAOYSA-N
XLogP2.69
TPSA56.26 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500303.79
LogP ≤ 52.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride?
The IUPAC name of 6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride (CID 112572719) is 6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride.
What is the SMILES notation for 6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride?
The canonical SMILES for 6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride is O=S(=O)(Cl)c1ccc(OCCc2cccs2)nc1.
What is the InChIKey of 6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride?
The InChIKey is VYWREPOBUXAJBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO3S2/c12-18(14,15)10-3-4-11(13-8-10)16-6-5-9-2-1-7-17-9/h1-4,7-8H,5-6H2.
What are the key properties of 6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride?
6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride has a molecular weight of 303.79 g/mol, XLogP of 2.69, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-thiophen-2-ylethoxy)pyridine-3-sulfonyl chloride is sourced from PubChem (CID 112572719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).