C9H8ClN3OS — CID 115001002
3-chloro-5-(2-thiophen-2-ylethoxy)-1,2,4-triazine (PubChem CID 115001002) has the molecular formula C9H8ClN3OS and a molecular weight of 241.70 g/mol. Its IUPAC name is 3-chloro-5-(2-thiophen-2-ylethoxy)-1,2,4-triazine.
| Compound Name | 3-chloro-5-(2-thiophen-2-ylethoxy)-1,2,4-triazine |
|---|---|
| PubChem CID | 115001002 |
| Molecular Formula | C9H8ClN3OS |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 3-chloro-5-(2-thiophen-2-ylethoxy)-1,2,4-triazine |
| SMILES | Clc1nncc(OCCc2cccs2)n1 |
| InChI | InChI=1S/C9H8ClN3OS/c10-9-12-8(6-11-13-9)14-4-3-7-2-1-5-15-7/h1-2,5-6H,3-4H2 |
| InChIKey | BMXPIFOHOLIMHO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |