C12H15N3OS — CID 80872249
N,4-dimethyl-6-(2-thiophen-2-ylethoxy)pyrimidin-2-amine (PubChem CID 80872249) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is N,4-dimethyl-6-(2-thiophen-2-ylethoxy)pyrimidin-2-amine.
| Compound Name | N,4-dimethyl-6-(2-thiophen-2-ylethoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80872249 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | N,4-dimethyl-6-(2-thiophen-2-ylethoxy)pyrimidin-2-amine |
| SMILES | CNc1nc(C)cc(OCCc2cccs2)n1 |
| InChI | InChI=1S/C12H15N3OS/c1-9-8-11(15-12(13-2)14-9)16-6-5-10-4-3-7-17-10/h3-4,7-8H,5-6H2,1-2H3,(H,13,14,15) |
| InChIKey | ACKOWUXLEOBZMZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |