C10H17N3O — CID 80860281
N,4-dimethyl-6-(2-methylpropoxy)pyrimidin-2-amine (PubChem CID 80860281) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is N,4-dimethyl-6-(2-methylpropoxy)pyrimidin-2-amine.
| Compound Name | N,4-dimethyl-6-(2-methylpropoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80860281 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | N,4-dimethyl-6-(2-methylpropoxy)pyrimidin-2-amine |
| SMILES | CNc1nc(C)cc(OCC(C)C)n1 |
| InChI | InChI=1S/C10H17N3O/c1-7(2)6-14-9-5-8(3)12-10(11-4)13-9/h5,7H,6H2,1-4H3,(H,11,12,13) |
| InChIKey | NQJZTYWCCYDGMW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |