C11H13N3OS — CID 80873043
N,4-dimethyl-6-(thiophen-2-ylmethoxy)pyrimidin-2-amine (PubChem CID 80873043) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is N,4-dimethyl-6-(thiophen-2-ylmethoxy)pyrimidin-2-amine.
| Compound Name | N,4-dimethyl-6-(thiophen-2-ylmethoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 80873043 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N,4-dimethyl-6-(thiophen-2-ylmethoxy)pyrimidin-2-amine |
| SMILES | CNc1nc(C)cc(OCc2cccs2)n1 |
| InChI | InChI=1S/C11H13N3OS/c1-8-6-10(14-11(12-2)13-8)15-7-9-4-3-5-16-9/h3-6H,7H2,1-2H3,(H,12,13,14) |
| InChIKey | AGOHKTAUOQSKSA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |