C10H11N3OS — CID 80872816
2-methyl-6-(thiophen-2-ylmethoxy)pyrimidin-4-amine (PubChem CID 80872816) has the molecular formula C10H11N3OS and a molecular weight of 221.29 g/mol. Its IUPAC name is 2-methyl-6-(thiophen-2-ylmethoxy)pyrimidin-4-amine.
| Compound Name | 2-methyl-6-(thiophen-2-ylmethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80872816 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 2-methyl-6-(thiophen-2-ylmethoxy)pyrimidin-4-amine |
| SMILES | Cc1nc(N)cc(OCc2cccs2)n1 |
| InChI | InChI=1S/C10H11N3OS/c1-7-12-9(11)5-10(13-7)14-6-8-3-2-4-15-8/h2-5H,6H2,1H3,(H2,11,12,13) |
| InChIKey | RZQHWGINTBMJFS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |