C16H12F3NO2S2 — CID 54250660
4-methyl-2-(thiophen-2-ylmethoxy)-6-[5-(trifluoromethyl)thiophen-3-yl]oxypyridine (PubChem CID 54250660) has the molecular formula C16H12F3NO2S2 and a molecular weight of 371.41 g/mol. Its IUPAC name is 4-methyl-2-(thiophen-2-ylmethoxy)-6-[5-(trifluoromethyl)thiophen-3-yl]oxypyridine.
| Compound Name | 4-methyl-2-(thiophen-2-ylmethoxy)-6-[5-(trifluoromethyl)thiophen-3-yl]oxypyridine |
|---|---|
| PubChem CID | 54250660 |
| Molecular Formula | C16H12F3NO2S2 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 4-methyl-2-(thiophen-2-ylmethoxy)-6-[5-(trifluoromethyl)thiophen-3-yl]oxypyridine |
| SMILES | Cc1cc(OCc2cccs2)nc(Oc2csc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H12F3NO2S2/c1-10-5-14(21-8-12-3-2-4-23-12)20-15(6-10)22-11-7-13(24-9-11)16(17,18)19/h2-7,9H,8H2,1H3 |
| InChIKey | QWMLFWHCSXUNBD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |