C16H23N3OS — CID 115974776
4-methyl-6-propoxy-N-(1-thiophen-2-ylbutyl)pyrimidin-2-amine (PubChem CID 115974776) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 4-methyl-6-propoxy-N-(1-thiophen-2-ylbutyl)pyrimidin-2-amine.
| Compound Name | 4-methyl-6-propoxy-N-(1-thiophen-2-ylbutyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 115974776 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 4-methyl-6-propoxy-N-(1-thiophen-2-ylbutyl)pyrimidin-2-amine |
| SMILES | CCCOc1cc(C)nc(NC(CCC)c2cccs2)n1 |
| InChI | InChI=1S/C16H23N3OS/c1-4-7-13(14-8-6-10-21-14)18-16-17-12(3)11-15(19-16)20-9-5-2/h6,8,10-11,13H,4-5,7,9H2,1-3H3,(H,17,18,19) |
| InChIKey | DERXGJVBBMMSRO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |