C8H5Cl2N3OS — CID 81036270
3,6-dichloro-5-(thiophen-2-ylmethoxy)-1,2,4-triazine (PubChem CID 81036270) has the molecular formula C8H5Cl2N3OS and a molecular weight of 262.12 g/mol. Its IUPAC name is 3,6-dichloro-5-(thiophen-2-ylmethoxy)-1,2,4-triazine.
| Compound Name | 3,6-dichloro-5-(thiophen-2-ylmethoxy)-1,2,4-triazine |
|---|---|
| PubChem CID | 81036270 |
| Molecular Formula | C8H5Cl2N3OS |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 260.95 |
| IUPAC Name | 3,6-dichloro-5-(thiophen-2-ylmethoxy)-1,2,4-triazine |
| SMILES | Clc1nnc(Cl)c(OCc2cccs2)n1 |
| InChI | InChI=1S/C8H5Cl2N3OS/c9-6-7(11-8(10)13-12-6)14-4-5-2-1-3-15-5/h1-3H,4H2 |
| InChIKey | NTFMIJSZCUBBDB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |