C13H13N3O2S3 — CID 60929148
N,N-bis(thiophen-2-ylmethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 60929148) has the molecular formula C13H13N3O2S3 and a molecular weight of 339.47 g/mol. Its IUPAC name is N,N-bis(thiophen-2-ylmethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | N,N-bis(thiophen-2-ylmethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 60929148 |
| Molecular Formula | C13H13N3O2S3 |
| Molecular Weight | 339.47 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | N,N-bis(thiophen-2-ylmethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | O=S(=O)(c1cn[nH]c1)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C13H13N3O2S3/c17-21(18,13-7-14-15-8-13)16(9-11-3-1-5-19-11)10-12-4-2-6-20-12/h1-8H,9-10H2,(H,14,15) |
| InChIKey | NCTIAFVSZQQSJK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |