C14H15BrClNO3S2 — CID 43019357
4-bromo-2-chloro-N-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 43019357) has the molecular formula C14H15BrClNO3S2 and a molecular weight of 424.77 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-chloro-N-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43019357 |
| Molecular Formula | C14H15BrClNO3S2 |
| Molecular Weight | 424.77 g/mol |
| Exact Mass | 422.94 |
| IUPAC Name | 4-bromo-2-chloro-N-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | COCCN(Cc1cccs1)S(=O)(=O)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H15BrClNO3S2/c1-20-7-6-17(10-12-3-2-8-21-12)22(18,19)14-5-4-11(15)9-13(14)16/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | MDBFCMVROSBGPQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.77 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |