C16H10O4 — CID 139694615
8-phenyl-[1,3]dioxolo[4,5-f]isochromen-6-one (PubChem CID 139694615) has the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. Its IUPAC name is 8-phenyl-[1,3]dioxolo[4,5-f]isochromen-6-one.
| Compound Name | 8-phenyl-[1,3]dioxolo[4,5-f]isochromen-6-one |
|---|---|
| PubChem CID | 139694615 |
| Molecular Formula | C16H10O4 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 8-phenyl-[1,3]dioxolo[4,5-f]isochromen-6-one |
| SMILES | O=c1oc(-c2ccccc2)cc2c3c(ccc12)OCO3 |
| InChI | InChI=1S/C16H10O4/c17-16-11-6-7-13-15(19-9-18-13)12(11)8-14(20-16)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | NCPXNGHAHQFZEP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |