C22H12O5 — CID 12027710
4,11-diphenyl-3,8,12-trioxatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10-tetraene-7,13-dione (PubChem CID 12027710) has the molecular formula C22H12O5 and a molecular weight of 356.33 g/mol. Its IUPAC name is 4,11-diphenyl-3,8,12-trioxatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10-tetraene-7,13-dione.
| Compound Name | 4,11-diphenyl-3,8,12-trioxatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10-tetraene-7,13-dione |
|---|---|
| PubChem CID | 12027710 |
| Molecular Formula | C22H12O5 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 4,11-diphenyl-3,8,12-trioxatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10-tetraene-7,13-dione |
| SMILES | O=c1oc2cc(-c3ccccc3)oc(=O)c2c2oc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C22H12O5/c23-21-15-11-16(13-7-3-1-4-8-13)25-20(15)19-18(27-21)12-17(26-22(19)24)14-9-5-2-6-10-14/h1-12H |
| InChIKey | GIQHARJRQHZDBH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |