C19H12O2 — CID 165369387
3-phenylazuleno[1,2-c]pyran-1-one (PubChem CID 165369387) has the molecular formula C19H12O2 and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-phenylazuleno[1,2-c]pyran-1-one.
| Compound Name | 3-phenylazuleno[1,2-c]pyran-1-one |
|---|---|
| PubChem CID | 165369387 |
| Molecular Formula | C19H12O2 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3-phenylazuleno[1,2-c]pyran-1-one |
| SMILES | O=c1oc(-c2ccccc2)cc2cc3cccccc-3c12 |
| InChI | InChI=1S/C19H12O2/c20-19-18-15(11-14-9-5-2-6-10-16(14)18)12-17(21-19)13-7-3-1-4-8-13/h1-12H |
| InChIKey | IEZKGNMRCHYYGK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |