C17H12Cl2O4 — CID 15826150
6,8-dichloro-5,7-dimethoxy-2-phenylchromen-4-one (PubChem CID 15826150) has the molecular formula C17H12Cl2O4 and a molecular weight of 351.19 g/mol. Its IUPAC name is 6,8-dichloro-5,7-dimethoxy-2-phenylchromen-4-one.
| Compound Name | 6,8-dichloro-5,7-dimethoxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 15826150 |
| Molecular Formula | C17H12Cl2O4 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 6,8-dichloro-5,7-dimethoxy-2-phenylchromen-4-one |
| SMILES | COc1c(Cl)c(OC)c2c(=O)cc(-c3ccccc3)oc2c1Cl |
| InChI | InChI=1S/C17H12Cl2O4/c1-21-15-12-10(20)8-11(9-6-4-3-5-7-9)23-16(12)14(19)17(22-2)13(15)18/h3-8H,1-2H3 |
| InChIKey | NVOILQOWVPAHRS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |