C15H6F4O2 — CID 91434765
5,6,7,8-tetrafluoro-2-phenylchromen-4-one (PubChem CID 91434765) has the molecular formula C15H6F4O2 and a molecular weight of 294.20 g/mol. Its IUPAC name is 5,6,7,8-tetrafluoro-2-phenylchromen-4-one.
| Compound Name | 5,6,7,8-tetrafluoro-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 91434765 |
| Molecular Formula | C15H6F4O2 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 5,6,7,8-tetrafluoro-2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C15H6F4O2/c16-11-10-8(20)6-9(7-4-2-1-3-5-7)21-15(10)14(19)13(18)12(11)17/h1-6H |
| InChIKey | WULBMHXRUODZOX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|