C19H18O6 — CID 25141901
5,7-dihydroxy-6,8-bis(methoxymethyl)-2-phenylchromen-4-one (PubChem CID 25141901) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is 5,7-dihydroxy-6,8-bis(methoxymethyl)-2-phenylchromen-4-one.
| Compound Name | 5,7-dihydroxy-6,8-bis(methoxymethyl)-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 25141901 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 5,7-dihydroxy-6,8-bis(methoxymethyl)-2-phenylchromen-4-one |
| SMILES | COCc1c(O)c(COC)c2oc(-c3ccccc3)cc(=O)c2c1O |
| InChI | InChI=1S/C19H18O6/c1-23-9-12-17(21)13(10-24-2)19-16(18(12)22)14(20)8-15(25-19)11-6-4-3-5-7-11/h3-8,21-22H,9-10H2,1-2H3 |
| InChIKey | CCNZCWVMDGAOCY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |