C29H36N2O4 — CID 3637360
5,7-dihydroxy-6,8-bis[(3-methylpiperidin-1-yl)methyl]-2-phenylchromen-4-one (PubChem CID 3637360) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is 5,7-dihydroxy-6,8-bis[(3-methylpiperidin-1-yl)methyl]-2-phenylchromen-4-one.
| Compound Name | 5,7-dihydroxy-6,8-bis[(3-methylpiperidin-1-yl)methyl]-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 3637360 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 5,7-dihydroxy-6,8-bis[(3-methylpiperidin-1-yl)methyl]-2-phenylchromen-4-one |
| SMILES | CC1CCCN(Cc2c(O)c(CN3CCCC(C)C3)c3oc(-c4ccccc4)cc(=O)c3c2O)C1 |
| InChI | InChI=1S/C29H36N2O4/c1-19-8-6-12-30(15-19)17-22-27(33)23(18-31-13-7-9-20(2)16-31)29-26(28(22)34)24(32)14-25(35-29)21-10-4-3-5-11-21/h3-5,10-11,14,19-20,33-34H,6-9,12-13,15-18H2,1-2H3 |
| InChIKey | XSJQHACBDRANOR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|