C21H22O6 — CID 141172325
6,8-bis(ethoxymethyl)-5,7-dihydroxy-2-phenylchromen-4-one (PubChem CID 141172325) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is 6,8-bis(ethoxymethyl)-5,7-dihydroxy-2-phenylchromen-4-one.
| Compound Name | 6,8-bis(ethoxymethyl)-5,7-dihydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 141172325 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 6,8-bis(ethoxymethyl)-5,7-dihydroxy-2-phenylchromen-4-one |
| SMILES | CCOCc1c(O)c(COCC)c2oc(-c3ccccc3)cc(=O)c2c1O |
| InChI | InChI=1S/C21H22O6/c1-3-25-11-14-19(23)15(12-26-4-2)21-18(20(14)24)16(22)10-17(27-21)13-8-6-5-7-9-13/h5-10,23-24H,3-4,11-12H2,1-2H3 |
| InChIKey | SRCMUUJKTDGACP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |