C20H18O4 — CID 5281903
5,7-dihydroxy-8-(3-methylbut-2-enyl)-2-phenylchromen-4-one (PubChem CID 5281903) has the molecular formula C20H18O4 and a molecular weight of 322.36 g/mol. Its IUPAC name is 5,7-dihydroxy-8-(3-methylbut-2-enyl)-2-phenylchromen-4-one.
| Compound Name | 5,7-dihydroxy-8-(3-methylbut-2-enyl)-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 5281903 |
| Molecular Formula | C20H18O4 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 5,7-dihydroxy-8-(3-methylbut-2-enyl)-2-phenylchromen-4-one |
| SMILES | CC(C)=CCc1c(O)cc(O)c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C20H18O4/c1-12(2)8-9-14-15(21)10-16(22)19-17(23)11-18(24-20(14)19)13-6-4-3-5-7-13/h3-8,10-11,21-22H,9H2,1-2H3 |
| InChIKey | WVBTWALEDCJRKA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|