C45H58O5 — CID 53305787
6,7-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-8-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-2-phenylchromen-4-one (PubChem CID 53305787) has the molecular formula C45H58O5 and a molecular weight of 678.95 g/mol. Its IUPAC name is 6,7-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-8-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-2-phenylchromen-4-one.
| Compound Name | 6,7-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-8-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 53305787 |
| Molecular Formula | C45H58O5 |
| Molecular Weight | 678.95 g/mol |
| Exact Mass | 678.43 |
| IUPAC Name | 6,7-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-8-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-2-phenylchromen-4-one |
| SMILES | CC(C)=CCC/C(C)=C/COc1c(OC/C=C(\C)CCC=C(C)C)c(O)c2c(=O)cc(-c3ccccc3)oc2c1C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C45H58O5/c1-31(2)16-13-19-34(7)24-25-38-43-41(39(46)30-40(50-43)37-22-11-10-12-23-37)42(47)45(49-29-27-36(9)21-15-18-33(5)6)44(38)48-28-26-35(8)20-14-17-32(3)4/h10-12,16-18,22-24,26-27,30,47H,13-15,19-21,25,28-29H2,1-9H3/b34-24+,35-26+,36-27+ |
| InChIKey | AKRUBPNAGFPFMZ-SIJAYTPOSA-N |
| XLogP | 12.54 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.95 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|