C21H22O4 — CID 11664684
9-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4-hydroxyfuro[3,2-g]chromen-7-one (PubChem CID 11664684) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is 9-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4-hydroxyfuro[3,2-g]chromen-7-one.
| Compound Name | 9-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4-hydroxyfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 11664684 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 9-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4-hydroxyfuro[3,2-g]chromen-7-one |
| SMILES | CC(C)=CCC/C(C)=C\Cc1c2occc2c(O)c2ccc(=O)oc12 |
| InChI | InChI=1S/C21H22O4/c1-13(2)5-4-6-14(3)7-8-17-20-16(11-12-24-20)19(23)15-9-10-18(22)25-21(15)17/h5,7,9-12,23H,4,6,8H2,1-3H3/b14-7- |
| InChIKey | VLZSECOGKOKMBC-AUWJEWJLSA-N |
| XLogP | 5.48 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|