C20H17ClO4 — CID 59152467
2-(4-chlorophenyl)-5,7-dihydroxy-8-(3-methylbut-2-enyl)chromen-4-one (PubChem CID 59152467) has the molecular formula C20H17ClO4 and a molecular weight of 356.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5,7-dihydroxy-8-(3-methylbut-2-enyl)chromen-4-one.
| Compound Name | 2-(4-chlorophenyl)-5,7-dihydroxy-8-(3-methylbut-2-enyl)chromen-4-one |
|---|---|
| PubChem CID | 59152467 |
| Molecular Formula | C20H17ClO4 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-(4-chlorophenyl)-5,7-dihydroxy-8-(3-methylbut-2-enyl)chromen-4-one |
| SMILES | CC(C)=CCc1c(O)cc(O)c2c(=O)cc(-c3ccc(Cl)cc3)oc12 |
| InChI | InChI=1S/C20H17ClO4/c1-11(2)3-8-14-15(22)9-16(23)19-17(24)10-18(25-20(14)19)12-4-6-13(21)7-5-12/h3-7,9-10,22-23H,8H2,1-2H3 |
| InChIKey | AIPBQKSXPXEGDS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|