C18H16O5 — CID 130427398
8-ethyl-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one (PubChem CID 130427398) has the molecular formula C18H16O5 and a molecular weight of 312.32 g/mol. Its IUPAC name is 8-ethyl-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one.
| Compound Name | 8-ethyl-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 130427398 |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 8-ethyl-5,7-dihydroxy-2-(4-methoxyphenyl)chromen-4-one |
| SMILES | CCc1c(O)cc(O)c2c(=O)cc(-c3ccc(OC)cc3)oc12 |
| InChI | InChI=1S/C18H16O5/c1-3-12-13(19)8-14(20)17-15(21)9-16(23-18(12)17)10-4-6-11(22-2)7-5-10/h4-9,19-20H,3H2,1-2H3 |
| InChIKey | PGWUJUOAXNAQNH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |