C19H14O5 — CID 175811145
5,7-dihydroxy-2-(4-methoxyphenyl)-8-prop-1-ynylchromen-4-one (PubChem CID 175811145) has the molecular formula C19H14O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is 5,7-dihydroxy-2-(4-methoxyphenyl)-8-prop-1-ynylchromen-4-one.
| Compound Name | 5,7-dihydroxy-2-(4-methoxyphenyl)-8-prop-1-ynylchromen-4-one |
|---|---|
| PubChem CID | 175811145 |
| Molecular Formula | C19H14O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 5,7-dihydroxy-2-(4-methoxyphenyl)-8-prop-1-ynylchromen-4-one |
| SMILES | CC#Cc1c(O)cc(O)c2c(=O)cc(-c3ccc(OC)cc3)oc12 |
| InChI | InChI=1S/C19H14O5/c1-3-4-13-14(20)9-15(21)18-16(22)10-17(24-19(13)18)11-5-7-12(23-2)8-6-11/h5-10,20-21H,1-2H3 |
| InChIKey | KBTMDOSSHRBOTQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|