C20H20O5 — CID 145159791
6,7-dimethoxy-2-(4-methoxyphenyl)-5,8-dimethylchromen-4-one (PubChem CID 145159791) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 6,7-dimethoxy-2-(4-methoxyphenyl)-5,8-dimethylchromen-4-one.
| Compound Name | 6,7-dimethoxy-2-(4-methoxyphenyl)-5,8-dimethylchromen-4-one |
|---|---|
| PubChem CID | 145159791 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 6,7-dimethoxy-2-(4-methoxyphenyl)-5,8-dimethylchromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3c(C)c(OC)c(OC)c(C)c3o2)cc1 |
| InChI | InChI=1S/C20H20O5/c1-11-17-15(21)10-16(13-6-8-14(22-3)9-7-13)25-18(17)12(2)20(24-5)19(11)23-4/h6-10H,1-5H3 |
| InChIKey | PLYNKDXICKZGJK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |