C18H16O9S — CID 102584177
7-hydroxy-5,8-dimethoxy-2-(4-methoxyphenyl)-4-oxochromene-6-sulfonic acid (PubChem CID 102584177) has the molecular formula C18H16O9S and a molecular weight of 408.38 g/mol. Its IUPAC name is 7-hydroxy-5,8-dimethoxy-2-(4-methoxyphenyl)-4-oxochromene-6-sulfonic acid.
| Compound Name | 7-hydroxy-5,8-dimethoxy-2-(4-methoxyphenyl)-4-oxochromene-6-sulfonic acid |
|---|---|
| PubChem CID | 102584177 |
| Molecular Formula | C18H16O9S |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 7-hydroxy-5,8-dimethoxy-2-(4-methoxyphenyl)-4-oxochromene-6-sulfonic acid |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c(S(=O)(=O)O)c(O)c(OC)c3o2)cc1 |
| InChI | InChI=1S/C18H16O9S/c1-24-10-6-4-9(5-7-10)12-8-11(19)13-15(27-12)17(26-3)14(20)18(16(13)25-2)28(21,22)23/h4-8,20H,1-3H3,(H,21,22,23) |
| InChIKey | XLWPNNLPQFZOGP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|