C16H10F2O3 — CID 171716334
6,8-difluoro-2-(4-methoxyphenyl)chromen-4-one (PubChem CID 171716334) has the molecular formula C16H10F2O3 and a molecular weight of 288.25 g/mol. Its IUPAC name is 6,8-difluoro-2-(4-methoxyphenyl)chromen-4-one.
| Compound Name | 6,8-difluoro-2-(4-methoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 171716334 |
| Molecular Formula | C16H10F2O3 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 6,8-difluoro-2-(4-methoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3cc(F)cc(F)c3o2)cc1 |
| InChI | InChI=1S/C16H10F2O3/c1-20-11-4-2-9(3-5-11)15-8-14(19)12-6-10(17)7-13(18)16(12)21-15/h2-8H,1H3 |
| InChIKey | AWWQZBYQWPQAAY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |