C22H21NO4 — CID 155558033
8-hydroxy-7-[(3-methylpiperidin-1-yl)methyl]-[1]benzofuro[3,2-c]chromen-6-one (PubChem CID 155558033) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 8-hydroxy-7-[(3-methylpiperidin-1-yl)methyl]-[1]benzofuro[3,2-c]chromen-6-one.
| Compound Name | 8-hydroxy-7-[(3-methylpiperidin-1-yl)methyl]-[1]benzofuro[3,2-c]chromen-6-one |
|---|---|
| PubChem CID | 155558033 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 8-hydroxy-7-[(3-methylpiperidin-1-yl)methyl]-[1]benzofuro[3,2-c]chromen-6-one |
| SMILES | CC1CCCN(Cc2c(O)ccc3oc4c5ccccc5oc(=O)c4c23)C1 |
| InChI | InChI=1S/C22H21NO4/c1-13-5-4-10-23(11-13)12-15-16(24)8-9-18-19(15)20-21(26-18)14-6-2-3-7-17(14)27-22(20)25/h2-3,6-9,13,24H,4-5,10-12H2,1H3 |
| InChIKey | XYSWUWMAPXGESX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|