C21H17NO5 — CID 155568635
1-[(8-hydroxy-6-oxo-[1]benzofuro[3,2-c]chromen-7-yl)methyl]piperidin-2-one (PubChem CID 155568635) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is 1-[(8-hydroxy-6-oxo-[1]benzofuro[3,2-c]chromen-7-yl)methyl]piperidin-2-one.
| Compound Name | 1-[(8-hydroxy-6-oxo-[1]benzofuro[3,2-c]chromen-7-yl)methyl]piperidin-2-one |
|---|---|
| PubChem CID | 155568635 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 1-[(8-hydroxy-6-oxo-[1]benzofuro[3,2-c]chromen-7-yl)methyl]piperidin-2-one |
| SMILES | O=C1CCCCN1Cc1c(O)ccc2oc3c4ccccc4oc(=O)c3c12 |
| InChI | InChI=1S/C21H17NO5/c23-14-8-9-16-18(13(14)11-22-10-4-3-7-17(22)24)19-20(26-16)12-5-1-2-6-15(12)27-21(19)25/h1-2,5-6,8-9,23H,3-4,7,10-11H2 |
| InChIKey | QQVMPEHAGYGZFU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|